C14H17N5O2 — CID 59285824
2-(carbamoylamino)-5-[3-(methylaminomethyl)phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 59285824) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[3-(methylaminomethyl)phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-[3-(methylaminomethyl)phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59285824 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-(carbamoylamino)-5-[3-(methylaminomethyl)phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | CNCc1cccc(-c2cc(C(N)=O)c(NC(N)=O)[nH]2)c1 |
| InChI | InChI=1S/C14H17N5O2/c1-17-7-8-3-2-4-9(5-8)11-6-10(12(15)20)13(18-11)19-14(16)21/h2-6,17-18H,7H2,1H3,(H2,15,20)(H3,16,19,21) |
| InChIKey | JFSRJNJQAOSNKX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 126.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |