C11H11N5O2 — CID 59285878
2-(carbamoylamino)-5-pyridin-3-yl-1H-pyrrole-3-carboxamide (PubChem CID 59285878) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-pyridin-3-yl-1H-pyrrole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-pyridin-3-yl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59285878 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-(carbamoylamino)-5-pyridin-3-yl-1H-pyrrole-3-carboxamide |
| SMILES | NC(=O)Nc1[nH]c(-c2cccnc2)cc1C(N)=O |
| InChI | InChI=1S/C11H11N5O2/c12-9(17)7-4-8(6-2-1-3-14-5-6)15-10(7)16-11(13)18/h1-5,15H,(H2,12,17)(H3,13,16,18) |
| InChIKey | LUYLIELBZBNVFJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |