C20H23N5O3 — CID 59189843
2-(carbamoylamino)-6-[3-[(2-methoxyethylamino)methyl]phenyl]-1H-indole-3-carboxamide (PubChem CID 59189843) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-(carbamoylamino)-6-[3-[(2-methoxyethylamino)methyl]phenyl]-1H-indole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-6-[3-[(2-methoxyethylamino)methyl]phenyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 59189843 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-(carbamoylamino)-6-[3-[(2-methoxyethylamino)methyl]phenyl]-1H-indole-3-carboxamide |
| SMILES | COCCNCc1cccc(-c2ccc3c(C(N)=O)c(NC(N)=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C20H23N5O3/c1-28-8-7-23-11-12-3-2-4-13(9-12)14-5-6-15-16(10-14)24-19(25-20(22)27)17(15)18(21)26/h2-6,9-10,23-24H,7-8,11H2,1H3,(H2,21,26)(H3,22,25,27) |
| InChIKey | DIKRBSWOOWSTNO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 135.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|