C16H15N5O2 — CID 59189917
6-(3-aminophenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide (PubChem CID 59189917) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 6-(3-aminophenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide.
| Compound Name | 6-(3-aminophenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 59189917 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 6-(3-aminophenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide |
| SMILES | NC(=O)Nc1[nH]c2cc(-c3cccc(N)c3)ccc2c1C(N)=O |
| InChI | InChI=1S/C16H15N5O2/c17-10-3-1-2-8(6-10)9-4-5-11-12(7-9)20-15(21-16(19)23)13(11)14(18)22/h1-7,20H,17H2,(H2,18,22)(H3,19,21,23) |
| InChIKey | NBPICAWZPBYCSB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 140.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|