C18H18N4O3 — CID 24988330
2-(carbamoylamino)-6-[3-(2-hydroxyethyl)phenyl]-1H-indole-3-carboxamide (PubChem CID 24988330) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-(carbamoylamino)-6-[3-(2-hydroxyethyl)phenyl]-1H-indole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-6-[3-(2-hydroxyethyl)phenyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 24988330 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-(carbamoylamino)-6-[3-(2-hydroxyethyl)phenyl]-1H-indole-3-carboxamide |
| SMILES | NC(=O)Nc1[nH]c2cc(-c3cccc(CCO)c3)ccc2c1C(N)=O |
| InChI | InChI=1S/C18H18N4O3/c19-16(24)15-13-5-4-12(9-14(13)21-17(15)22-18(20)25)11-3-1-2-10(8-11)6-7-23/h1-5,8-9,21,23H,6-7H2,(H2,19,24)(H3,20,22,25) |
| InChIKey | CUJOMLNAJOLTOY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |