C22H30N6O2 — CID 143724224
6-[3-[[2-(dimethylamino)ethylamino]methyl]phenyl]-2-(methylamino)-1H-indole-3-carboxamide;formamide (PubChem CID 143724224) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 6-[3-[[2-(dimethylamino)ethylamino]methyl]phenyl]-2-(methylamino)-1H-indole-3-carboxamide;formamide.
| Compound Name | 6-[3-[[2-(dimethylamino)ethylamino]methyl]phenyl]-2-(methylamino)-1H-indole-3-carboxamide;formamide |
|---|---|
| PubChem CID | 143724224 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 6-[3-[[2-(dimethylamino)ethylamino]methyl]phenyl]-2-(methylamino)-1H-indole-3-carboxamide;formamide |
| SMILES | CNc1[nH]c2cc(-c3cccc(CNCCN(C)C)c3)ccc2c1C(N)=O.NC=O |
| InChI | InChI=1S/C21H27N5O.CH3NO/c1-23-21-19(20(22)27)17-8-7-16(12-18(17)25-21)15-6-4-5-14(11-15)13-24-9-10-26(2)3;2-1-3/h4-8,11-12,23-25H,9-10,13H2,1-3H3,(H2,22,27);1H,(H2,2,3) |
| InChIKey | MZFFDGVRHIRXRO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|