C14H16N4O3 — CID 145464595
2-(carbamoylamino)-5-(5-ethyl-2-hydroxyphenyl)-1H-pyrrole-3-carboxamide (PubChem CID 145464595) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-(5-ethyl-2-hydroxyphenyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-(5-ethyl-2-hydroxyphenyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 145464595 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-(carbamoylamino)-5-(5-ethyl-2-hydroxyphenyl)-1H-pyrrole-3-carboxamide |
| SMILES | CCc1ccc(O)c(-c2cc(C(N)=O)c(NC(N)=O)[nH]2)c1 |
| InChI | InChI=1S/C14H16N4O3/c1-2-7-3-4-11(19)8(5-7)10-6-9(12(15)20)13(17-10)18-14(16)21/h3-6,17,19H,2H2,1H3,(H2,15,20)(H3,16,18,21) |
| InChIKey | FSAMKGQOJPIEPF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |