C15H20N4O3 — CID 145464622
2-amino-5-(5-ethyl-2-methoxyphenyl)-1H-pyrrole-3-carboxamide;formamide (PubChem CID 145464622) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-amino-5-(5-ethyl-2-methoxyphenyl)-1H-pyrrole-3-carboxamide;formamide.
| Compound Name | 2-amino-5-(5-ethyl-2-methoxyphenyl)-1H-pyrrole-3-carboxamide;formamide |
|---|---|
| PubChem CID | 145464622 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-amino-5-(5-ethyl-2-methoxyphenyl)-1H-pyrrole-3-carboxamide;formamide |
| SMILES | CCc1ccc(OC)c(-c2cc(C(N)=O)c(N)[nH]2)c1.NC=O |
| InChI | InChI=1S/C14H17N3O2.CH3NO/c1-3-8-4-5-12(19-2)9(6-8)11-7-10(14(16)18)13(15)17-11;2-1-3/h4-7,17H,3,15H2,1-2H3,(H2,16,18);1H,(H2,2,3) |
| InChIKey | QRGJIRGXPWHBOA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|