C23H24N2O5 — CID 139715528
ethyl 4-[3-acetyl-2-(1H-indole-5-carbonylamino)phenoxy]butanoate (PubChem CID 139715528) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is ethyl 4-[3-acetyl-2-(1H-indole-5-carbonylamino)phenoxy]butanoate.
| Compound Name | ethyl 4-[3-acetyl-2-(1H-indole-5-carbonylamino)phenoxy]butanoate |
|---|---|
| PubChem CID | 139715528 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | ethyl 4-[3-acetyl-2-(1H-indole-5-carbonylamino)phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cccc(C(C)=O)c1NC(=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C23H24N2O5/c1-3-29-21(27)8-5-13-30-20-7-4-6-18(15(2)26)22(20)25-23(28)17-9-10-19-16(14-17)11-12-24-19/h4,6-7,9-12,14,24H,3,5,8,13H2,1-2H3,(H,25,28) |
| InChIKey | CXTBINFBOVENNZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|