C25H30ClNO5 — CID 67788758
4-[2-[(3-chloro-4-oct-1-enoxybenzoyl)amino]phenoxy]butanoic acid (PubChem CID 67788758) has the molecular formula C25H30ClNO5 and a molecular weight of 459.97 g/mol. Its IUPAC name is 4-[2-[(3-chloro-4-oct-1-enoxybenzoyl)amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[(3-chloro-4-oct-1-enoxybenzoyl)amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67788758 |
| Molecular Formula | C25H30ClNO5 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 4-[2-[(3-chloro-4-oct-1-enoxybenzoyl)amino]phenoxy]butanoic acid |
| SMILES | CCCCCCC=COc1ccc(C(=O)Nc2ccccc2OCCCC(=O)O)cc1Cl |
| InChI | InChI=1S/C25H30ClNO5/c1-2-3-4-5-6-9-16-31-22-15-14-19(18-20(22)26)25(30)27-21-11-7-8-12-23(21)32-17-10-13-24(28)29/h7-9,11-12,14-16,18H,2-6,10,13,17H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | JQZMYRZNWXFLEE-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|