C26H20FN5O2 — CID 67113599
N-[3-fluoro-4-[4-(1H-pyrrole-3-carbonylamino)anilino]phenyl]-1H-indole-5-carboxamide (PubChem CID 67113599) has the molecular formula C26H20FN5O2 and a molecular weight of 453.48 g/mol. Its IUPAC name is N-[3-fluoro-4-[4-(1H-pyrrole-3-carbonylamino)anilino]phenyl]-1H-indole-5-carboxamide.
| Compound Name | N-[3-fluoro-4-[4-(1H-pyrrole-3-carbonylamino)anilino]phenyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 67113599 |
| Molecular Formula | C26H20FN5O2 |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[3-fluoro-4-[4-(1H-pyrrole-3-carbonylamino)anilino]phenyl]-1H-indole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(NC(=O)c3ccc4[nH]ccc4c3)cc2F)cc1)c1cc[nH]c1 |
| InChI | InChI=1S/C26H20FN5O2/c27-22-14-21(32-25(33)17-1-7-23-16(13-17)10-12-29-23)6-8-24(22)30-19-2-4-20(5-3-19)31-26(34)18-9-11-28-15-18/h1-15,28-30H,(H,31,34)(H,32,33) |
| InChIKey | MGNLAMFPIOKZCG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |