C18H16F2N4O — CID 139398477
N-[3-fluoro-4-[2-fluoro-4-(methylamino)anilino]phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 139398477) has the molecular formula C18H16F2N4O and a molecular weight of 342.35 g/mol. Its IUPAC name is N-[3-fluoro-4-[2-fluoro-4-(methylamino)anilino]phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-[3-fluoro-4-[2-fluoro-4-(methylamino)anilino]phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 139398477 |
| Molecular Formula | C18H16F2N4O |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[3-fluoro-4-[2-fluoro-4-(methylamino)anilino]phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | CNc1ccc(Nc2ccc(NC(=O)c3cc[nH]c3)cc2F)c(F)c1 |
| InChI | InChI=1S/C18H16F2N4O/c1-21-12-2-4-16(14(19)8-12)24-17-5-3-13(9-15(17)20)23-18(25)11-6-7-22-10-11/h2-10,21-22,24H,1H3,(H,23,25) |
| InChIKey | CHMITQYAYTUUBL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|