C13H12N4OS — CID 66374193
2-(1-aminoethyl)-N-(3-cyanophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 66374193) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-(3-cyanophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N-(3-cyanophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66374193 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-(1-aminoethyl)-N-(3-cyanophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)Nc2cccc(C#N)c2)cs1 |
| InChI | InChI=1S/C13H12N4OS/c1-8(15)13-17-11(7-19-13)12(18)16-10-4-2-3-9(5-10)6-14/h2-5,7-8H,15H2,1H3,(H,16,18) |
| InChIKey | NDHFELKFOUNFOF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |