C10H13N3O2S2 — CID 3855660
2-(1-aminoethyl)-N-(2-oxothiolan-3-yl)-1,3-thiazole-4-carboxamide (PubChem CID 3855660) has the molecular formula C10H13N3O2S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-(2-oxothiolan-3-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N-(2-oxothiolan-3-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3855660 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-(1-aminoethyl)-N-(2-oxothiolan-3-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)NC2CCSC2=O)cs1 |
| InChI | InChI=1S/C10H13N3O2S2/c1-5(11)9-13-7(4-17-9)8(14)12-6-2-3-16-10(6)15/h4-6H,2-3,11H2,1H3,(H,12,14) |
| InChIKey | XQHKCVSXSTWIJY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|