C13H17ClFN5O — CID 119406415
N-(3-aminopropyl)-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide;hydrochloride (PubChem CID 119406415) has the molecular formula C13H17ClFN5O and a molecular weight of 313.76 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119406415 |
| Molecular Formula | C13H17ClFN5O |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-(3-aminopropyl)-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)c1cn(Cc2cccc(F)c2)nn1 |
| InChI | InChI=1S/C13H16FN5O.ClH/c14-11-4-1-3-10(7-11)8-19-9-12(17-18-19)13(20)16-6-2-5-15;/h1,3-4,7,9H,2,5-6,8,15H2,(H,16,20);1H |
| InChIKey | SGDUTWBPQNYAMF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|