C16H19FN4O3 — CID 120615410
(2S)-2-[[1-[(3-fluorophenyl)methyl]triazole-4-carbonyl]amino]hexanoic acid (PubChem CID 120615410) has the molecular formula C16H19FN4O3 and a molecular weight of 334.35 g/mol. Its IUPAC name is (2S)-2-[[1-[(3-fluorophenyl)methyl]triazole-4-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[1-[(3-fluorophenyl)methyl]triazole-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120615410 |
| Molecular Formula | C16H19FN4O3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2S)-2-[[1-[(3-fluorophenyl)methyl]triazole-4-carbonyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)c1cn(Cc2cccc(F)c2)nn1)C(=O)O |
| InChI | InChI=1S/C16H19FN4O3/c1-2-3-7-13(16(23)24)18-15(22)14-10-21(20-19-14)9-11-5-4-6-12(17)8-11/h4-6,8,10,13H,2-3,7,9H2,1H3,(H,18,22)(H,23,24)/t13-/m0/s1 |
| InChIKey | YXSMSSYRWAFMHT-ZDUSSCGKSA-N |
| XLogP | 1.84 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |