C21H24FN5O3S — CID 146123313
N-[3-(butan-2-ylsulfamoylmethyl)phenyl]-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide (PubChem CID 146123313) has the molecular formula C21H24FN5O3S and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[3-(butan-2-ylsulfamoylmethyl)phenyl]-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide.
| Compound Name | N-[3-(butan-2-ylsulfamoylmethyl)phenyl]-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 146123313 |
| Molecular Formula | C21H24FN5O3S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[3-(butan-2-ylsulfamoylmethyl)phenyl]-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide |
| SMILES | CCC(C)NS(=O)(=O)Cc1cccc(NC(=O)c2cn(Cc3cccc(F)c3)nn2)c1 |
| InChI | InChI=1S/C21H24FN5O3S/c1-3-15(2)25-31(29,30)14-17-7-5-9-19(11-17)23-21(28)20-13-27(26-24-20)12-16-6-4-8-18(22)10-16/h4-11,13,15,25H,3,12,14H2,1-2H3,(H,23,28) |
| InChIKey | MVPBFWALXPKRCT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |