C14H19ClFN5O — CID 119506466
N-[2-(ethylamino)ethyl]-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide;hydrochloride (PubChem CID 119506466) has the molecular formula C14H19ClFN5O and a molecular weight of 327.79 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119506466 |
| Molecular Formula | C14H19ClFN5O |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1cn(Cc2cccc(F)c2)nn1.Cl |
| InChI | InChI=1S/C14H18FN5O.ClH/c1-2-16-6-7-17-14(21)13-10-20(19-18-13)9-11-4-3-5-12(15)8-11;/h3-5,8,10,16H,2,6-7,9H2,1H3,(H,17,21);1H |
| InChIKey | XWAWAWLKKPSIGY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|