C17H23N3O3S — CID 97101295
N-[3-[[(2S)-butan-2-yl]sulfamoylmethyl]phenyl]-2-methyl-1H-pyrrole-3-carboxamide (PubChem CID 97101295) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[3-[[(2S)-butan-2-yl]sulfamoylmethyl]phenyl]-2-methyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[3-[[(2S)-butan-2-yl]sulfamoylmethyl]phenyl]-2-methyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 97101295 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[3-[[(2S)-butan-2-yl]sulfamoylmethyl]phenyl]-2-methyl-1H-pyrrole-3-carboxamide |
| SMILES | CC[C@H](C)NS(=O)(=O)Cc1cccc(NC(=O)c2cc[nH]c2C)c1 |
| InChI | InChI=1S/C17H23N3O3S/c1-4-12(2)20-24(22,23)11-14-6-5-7-15(10-14)19-17(21)16-8-9-18-13(16)3/h5-10,12,18,20H,4,11H2,1-3H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | WNWULAWXRHTVKO-LBPRGKRZSA-N |
| XLogP | 2.79 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |