C18H21N3O5S — CID 122056207
2-[[3-(butan-2-ylsulfamoylmethyl)phenyl]carbamoyl]pyridine-4-carboxylic acid (PubChem CID 122056207) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[[3-(butan-2-ylsulfamoylmethyl)phenyl]carbamoyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[[3-(butan-2-ylsulfamoylmethyl)phenyl]carbamoyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 122056207 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[[3-(butan-2-ylsulfamoylmethyl)phenyl]carbamoyl]pyridine-4-carboxylic acid |
| SMILES | CCC(C)NS(=O)(=O)Cc1cccc(NC(=O)c2cc(C(=O)O)ccn2)c1 |
| InChI | InChI=1S/C18H21N3O5S/c1-3-12(2)21-27(25,26)11-13-5-4-6-15(9-13)20-17(22)16-10-14(18(23)24)7-8-19-16/h4-10,12,21H,3,11H2,1-2H3,(H,20,22)(H,23,24) |
| InChIKey | CBNUQBIGZYQAPD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |