C16H26N2O2S2 — CID 97079815
N-[(2R)-butan-2-yl]-1-[3-(thian-4-ylamino)phenyl]methanesulfonamide (PubChem CID 97079815) has the molecular formula C16H26N2O2S2 and a molecular weight of 342.53 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-1-[3-(thian-4-ylamino)phenyl]methanesulfonamide.
| Compound Name | N-[(2R)-butan-2-yl]-1-[3-(thian-4-ylamino)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 97079815 |
| Molecular Formula | C16H26N2O2S2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[(2R)-butan-2-yl]-1-[3-(thian-4-ylamino)phenyl]methanesulfonamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)Cc1cccc(NC2CCSCC2)c1 |
| InChI | InChI=1S/C16H26N2O2S2/c1-3-13(2)18-22(19,20)12-14-5-4-6-16(11-14)17-15-7-9-21-10-8-15/h4-6,11,13,15,17-18H,3,7-10,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | PWYYGDZYBCHEAR-CYBMUJFWSA-N |
| XLogP | 3.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |