C20H23ClFN5O — CID 119548307
N-[2-(4-aminophenyl)ethyl]-1-(3-fluorophenyl)-5-propan-2-yl-1,2,4-triazole-3-carboxamide;hydrochloride (PubChem CID 119548307) has the molecular formula C20H23ClFN5O and a molecular weight of 403.89 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-1-(3-fluorophenyl)-5-propan-2-yl-1,2,4-triazole-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-1-(3-fluorophenyl)-5-propan-2-yl-1,2,4-triazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119548307 |
| Molecular Formula | C20H23ClFN5O |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-1-(3-fluorophenyl)-5-propan-2-yl-1,2,4-triazole-3-carboxamide;hydrochloride |
| SMILES | CC(C)c1nc(C(=O)NCCc2ccc(N)cc2)nn1-c1cccc(F)c1.Cl |
| InChI | InChI=1S/C20H22FN5O.ClH/c1-13(2)19-24-18(25-26(19)17-5-3-4-15(21)12-17)20(27)23-11-10-14-6-8-16(22)9-7-14;/h3-9,12-13H,10-11,22H2,1-2H3,(H,23,27);1H |
| InChIKey | JRICUDIHSNUHIJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|