C25H31FN4O4S — CID 59178309
6-fluoro-N-[4-[4-[3-(methanesulfonamido)phenyl]piperazin-1-yl]butyl]-2H-chromene-3-carboxamide (PubChem CID 59178309) has the molecular formula C25H31FN4O4S and a molecular weight of 502.61 g/mol. Its IUPAC name is 6-fluoro-N-[4-[4-[3-(methanesulfonamido)phenyl]piperazin-1-yl]butyl]-2H-chromene-3-carboxamide.
| Compound Name | 6-fluoro-N-[4-[4-[3-(methanesulfonamido)phenyl]piperazin-1-yl]butyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 59178309 |
| Molecular Formula | C25H31FN4O4S |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 6-fluoro-N-[4-[4-[3-(methanesulfonamido)phenyl]piperazin-1-yl]butyl]-2H-chromene-3-carboxamide |
| SMILES | CS(=O)(=O)Nc1cccc(N2CCN(CCCCNC(=O)C3=Cc4cc(F)ccc4OC3)CC2)c1 |
| InChI | InChI=1S/C25H31FN4O4S/c1-35(32,33)28-22-5-4-6-23(17-22)30-13-11-29(12-14-30)10-3-2-9-27-25(31)20-15-19-16-21(26)7-8-24(19)34-18-20/h4-8,15-17,28H,2-3,9-14,18H2,1H3,(H,27,31) |
| InChIKey | DMSJIZVROOMPTA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|