C27H33N3O4 — CID 24888803
ethyl 4-[4-[4-(2H-chromene-3-carbonylamino)butyl]piperazin-1-yl]benzoate (PubChem CID 24888803) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is ethyl 4-[4-[4-(2H-chromene-3-carbonylamino)butyl]piperazin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[4-(2H-chromene-3-carbonylamino)butyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 24888803 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | ethyl 4-[4-[4-(2H-chromene-3-carbonylamino)butyl]piperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(CCCCNC(=O)C3=Cc4ccccc4OC3)CC2)cc1 |
| InChI | InChI=1S/C27H33N3O4/c1-2-33-27(32)21-9-11-24(12-10-21)30-17-15-29(16-18-30)14-6-5-13-28-26(31)23-19-22-7-3-4-8-25(22)34-20-23/h3-4,7-12,19H,2,5-6,13-18,20H2,1H3,(H,28,31) |
| InChIKey | HBXSJQYHDDWJHA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|