C25H30N4O5 — CID 59178314
6-methoxy-N-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]-2H-chromene-3-carboxamide (PubChem CID 59178314) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 6-methoxy-N-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]-2H-chromene-3-carboxamide.
| Compound Name | 6-methoxy-N-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 59178314 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 6-methoxy-N-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]-2H-chromene-3-carboxamide |
| SMILES | COc1ccc2c(c1)C=C(C(=O)NCCCCN1CCN(c3cccc([N+](=O)[O-])c3)CC1)CO2 |
| InChI | InChI=1S/C25H30N4O5/c1-33-23-7-8-24-19(16-23)15-20(18-34-24)25(30)26-9-2-3-10-27-11-13-28(14-12-27)21-5-4-6-22(17-21)29(31)32/h4-8,15-17H,2-3,9-14,18H2,1H3,(H,26,30) |
| InChIKey | JEWNYAVWNGEBIF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|