C22H26Cl2N4S — CID 56598875
N-[4-[4-(2,3-dichlorophenyl)-1,4-diazepan-1-yl]butyl]-1,3-benzothiazol-5-amine (PubChem CID 56598875) has the molecular formula C22H26Cl2N4S and a molecular weight of 449.45 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)-1,4-diazepan-1-yl]butyl]-1,3-benzothiazol-5-amine.
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)-1,4-diazepan-1-yl]butyl]-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 56598875 |
| Molecular Formula | C22H26Cl2N4S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)-1,4-diazepan-1-yl]butyl]-1,3-benzothiazol-5-amine |
| SMILES | Clc1cccc(N2CCCN(CCCCNc3ccc4scnc4c3)CC2)c1Cl |
| InChI | InChI=1S/C22H26Cl2N4S/c23-18-5-3-6-20(22(18)24)28-12-4-11-27(13-14-28)10-2-1-9-25-17-7-8-21-19(15-17)26-16-29-21/h3,5-8,15-16,25H,1-2,4,9-14H2 |
| InChIKey | VZJBQKJPCQPLCF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|