C24H30ClN3O2 — CID 159786414
butane;7-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]oxy-1H-quinolin-2-one (PubChem CID 159786414) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is butane;7-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]oxy-1H-quinolin-2-one.
| Compound Name | butane;7-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]oxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 159786414 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | butane;7-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]oxy-1H-quinolin-2-one |
| SMILES | CCCC.Cc1cccc(N2CCN(Oc3ccc4ccc(=O)[nH]c4c3)CC2)c1Cl |
| InChI | InChI=1S/C20H20ClN3O2.C4H10/c1-14-3-2-4-18(20(14)21)23-9-11-24(12-10-23)26-16-7-5-15-6-8-19(25)22-17(15)13-16;1-3-4-2/h2-8,13H,9-12H2,1H3,(H,22,25);3-4H2,1-2H3 |
| InChIKey | NHZRYBWRHKTENJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |