C25H44Cl2N4O — CID 170584725
6-amino-N-cyclohexylhexanamide;1-(2,3-dichlorophenyl)-4-ethylpiperazine;methane (PubChem CID 170584725) has the molecular formula C25H44Cl2N4O and a molecular weight of 487.56 g/mol. Its IUPAC name is 6-amino-N-cyclohexylhexanamide;1-(2,3-dichlorophenyl)-4-ethylpiperazine;methane.
| Compound Name | 6-amino-N-cyclohexylhexanamide;1-(2,3-dichlorophenyl)-4-ethylpiperazine;methane |
|---|---|
| PubChem CID | 170584725 |
| Molecular Formula | C25H44Cl2N4O |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 6-amino-N-cyclohexylhexanamide;1-(2,3-dichlorophenyl)-4-ethylpiperazine;methane |
| SMILES | C.CCN1CCN(c2cccc(Cl)c2Cl)CC1.NCCCCCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C12H16Cl2N2.C12H24N2O.CH4/c1-2-15-6-8-16(9-7-15)11-5-3-4-10(13)12(11)14;13-10-6-2-5-9-12(15)14-11-7-3-1-4-8-11;/h3-5H,2,6-9H2,1H3;11H,1-10,13H2,(H,14,15);1H4 |
| InChIKey | QBGFADNHTOYOIL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|