C22H33ClN4O — CID 143598704
1-(2-chloro-4-methylphenyl)-4-ethylpiperazine;2-cyano-N-cyclohexylacetamide (PubChem CID 143598704) has the molecular formula C22H33ClN4O and a molecular weight of 404.99 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-4-ethylpiperazine;2-cyano-N-cyclohexylacetamide.
| Compound Name | 1-(2-chloro-4-methylphenyl)-4-ethylpiperazine;2-cyano-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 143598704 |
| Molecular Formula | C22H33ClN4O |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-4-ethylpiperazine;2-cyano-N-cyclohexylacetamide |
| SMILES | CCN1CCN(c2ccc(C)cc2Cl)CC1.N#CCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H19ClN2.C9H14N2O/c1-3-15-6-8-16(9-7-15)13-5-4-11(2)10-12(13)14;10-7-6-9(12)11-8-4-2-1-3-5-8/h4-5,10H,3,6-9H2,1-2H3;8H,1-6H2,(H,11,12) |
| InChIKey | WXMMCVVTUXVOST-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |