C23H39ClN4O2 — CID 171492454
1-(3-chloro-5-ethyl-2-methoxyphenyl)-4-ethylpiperazine;1-cyclohexyl-3-methylurea (PubChem CID 171492454) has the molecular formula C23H39ClN4O2 and a molecular weight of 439.04 g/mol. Its IUPAC name is 1-(3-chloro-5-ethyl-2-methoxyphenyl)-4-ethylpiperazine;1-cyclohexyl-3-methylurea.
| Compound Name | 1-(3-chloro-5-ethyl-2-methoxyphenyl)-4-ethylpiperazine;1-cyclohexyl-3-methylurea |
|---|---|
| PubChem CID | 171492454 |
| Molecular Formula | C23H39ClN4O2 |
| Molecular Weight | 439.04 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 1-(3-chloro-5-ethyl-2-methoxyphenyl)-4-ethylpiperazine;1-cyclohexyl-3-methylurea |
| SMILES | CCc1cc(Cl)c(OC)c(N2CCN(CC)CC2)c1.CNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H23ClN2O.C8H16N2O/c1-4-12-10-13(16)15(19-3)14(11-12)18-8-6-17(5-2)7-9-18;1-9-8(11)10-7-5-3-2-4-6-7/h10-11H,4-9H2,1-3H3;7H,2-6H2,1H3,(H2,9,10,11) |
| InChIKey | UOMBWPATRSYSBP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.04 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |