C28H45N3 — CID 143598802
1-(2,4-diethylphenyl)-4-ethylpiperazine;N-hex-1-en-4-yn-2-ylcyclohexanamine (PubChem CID 143598802) has the molecular formula C28H45N3 and a molecular weight of 423.69 g/mol. Its IUPAC name is 1-(2,4-diethylphenyl)-4-ethylpiperazine;N-hex-1-en-4-yn-2-ylcyclohexanamine.
| Compound Name | 1-(2,4-diethylphenyl)-4-ethylpiperazine;N-hex-1-en-4-yn-2-ylcyclohexanamine |
|---|---|
| PubChem CID | 143598802 |
| Molecular Formula | C28H45N3 |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 423.36 |
| IUPAC Name | 1-(2,4-diethylphenyl)-4-ethylpiperazine;N-hex-1-en-4-yn-2-ylcyclohexanamine |
| SMILES | C=C(CC#CC)NC1CCCCC1.CCc1ccc(N2CCN(CC)CC2)c(CC)c1 |
| InChI | InChI=1S/C16H26N2.C12H19N/c1-4-14-7-8-16(15(5-2)13-14)18-11-9-17(6-3)10-12-18;1-3-4-8-11(2)13-12-9-6-5-7-10-12/h7-8,13H,4-6,9-12H2,1-3H3;12-13H,2,5-10H2,1H3 |
| InChIKey | KPYNIDULXXUAST-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|