C18H29Cl2FN4O — CID 119426574
4-(4-ethylpiperazin-1-yl)-3-fluoro-N-piperidin-3-ylbenzamide;dihydrochloride (PubChem CID 119426574) has the molecular formula C18H29Cl2FN4O and a molecular weight of 407.36 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-3-fluoro-N-piperidin-3-ylbenzamide;dihydrochloride.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-3-fluoro-N-piperidin-3-ylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 119426574 |
| Molecular Formula | C18H29Cl2FN4O |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-3-fluoro-N-piperidin-3-ylbenzamide;dihydrochloride |
| SMILES | CCN1CCN(c2ccc(C(=O)NC3CCCNC3)cc2F)CC1.Cl.Cl |
| InChI | InChI=1S/C18H27FN4O.2ClH/c1-2-22-8-10-23(11-9-22)17-6-5-14(12-16(17)19)18(24)21-15-4-3-7-20-13-15;;/h5-6,12,15,20H,2-4,7-11,13H2,1H3,(H,21,24);2*1H |
| InChIKey | QWKGFUUEQBZHPF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |