C19H31Cl2FN4O — CID 119442759
4-(4-ethylpiperazin-1-yl)-3-fluoro-N-methyl-N-piperidin-4-ylbenzamide;dihydrochloride (PubChem CID 119442759) has the molecular formula C19H31Cl2FN4O and a molecular weight of 421.39 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-3-fluoro-N-methyl-N-piperidin-4-ylbenzamide;dihydrochloride.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-3-fluoro-N-methyl-N-piperidin-4-ylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 119442759 |
| Molecular Formula | C19H31Cl2FN4O |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-3-fluoro-N-methyl-N-piperidin-4-ylbenzamide;dihydrochloride |
| SMILES | CCN1CCN(c2ccc(C(=O)N(C)C3CCNCC3)cc2F)CC1.Cl.Cl |
| InChI | InChI=1S/C19H29FN4O.2ClH/c1-3-23-10-12-24(13-11-23)18-5-4-15(14-17(18)20)19(25)22(2)16-6-8-21-9-7-16;;/h4-5,14,16,21H,3,6-13H2,1-2H3;2*1H |
| InChIKey | IKHFUCHPIRQLHU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |