C19H28FN3O3 — CID 119357271
4-[[4-(4-ethylpiperazin-1-yl)-3-fluorobenzoyl]amino]-4-methylpentanoic acid (PubChem CID 119357271) has the molecular formula C19H28FN3O3 and a molecular weight of 365.45 g/mol. Its IUPAC name is 4-[[4-(4-ethylpiperazin-1-yl)-3-fluorobenzoyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[4-(4-ethylpiperazin-1-yl)-3-fluorobenzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119357271 |
| Molecular Formula | C19H28FN3O3 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 4-[[4-(4-ethylpiperazin-1-yl)-3-fluorobenzoyl]amino]-4-methylpentanoic acid |
| SMILES | CCN1CCN(c2ccc(C(=O)NC(C)(C)CCC(=O)O)cc2F)CC1 |
| InChI | InChI=1S/C19H28FN3O3/c1-4-22-9-11-23(12-10-22)16-6-5-14(13-15(16)20)18(26)21-19(2,3)8-7-17(24)25/h5-6,13H,4,7-12H2,1-3H3,(H,21,26)(H,24,25) |
| InChIKey | YUOLBFYXYGTAIF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |