C25H42ClN3O2 — CID 171492412
tert-butyl N-cyclohexylcarbamate;1-(2-chloro-3-ethylphenyl)-4-ethylpiperazine (PubChem CID 171492412) has the molecular formula C25H42ClN3O2 and a molecular weight of 452.08 g/mol. Its IUPAC name is tert-butyl N-cyclohexylcarbamate;1-(2-chloro-3-ethylphenyl)-4-ethylpiperazine.
| Compound Name | tert-butyl N-cyclohexylcarbamate;1-(2-chloro-3-ethylphenyl)-4-ethylpiperazine |
|---|---|
| PubChem CID | 171492412 |
| Molecular Formula | C25H42ClN3O2 |
| Molecular Weight | 452.08 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | tert-butyl N-cyclohexylcarbamate;1-(2-chloro-3-ethylphenyl)-4-ethylpiperazine |
| SMILES | CC(C)(C)OC(=O)NC1CCCCC1.CCc1cccc(N2CCN(CC)CC2)c1Cl |
| InChI | InChI=1S/C14H21ClN2.C11H21NO2/c1-3-12-6-5-7-13(14(12)15)17-10-8-16(4-2)9-11-17;1-11(2,3)14-10(13)12-9-7-5-4-6-8-9/h5-7H,3-4,8-11H2,1-2H3;9H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | ZLSARPYAVIVCMH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.08 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |