C18H29NO3S — CID 170639542
tert-butyl N-cyclohexylcarbamate;(3-sulfanylphenyl)methanol (PubChem CID 170639542) has the molecular formula C18H29NO3S and a molecular weight of 339.50 g/mol. Its IUPAC name is tert-butyl N-cyclohexylcarbamate;(3-sulfanylphenyl)methanol.
| Compound Name | tert-butyl N-cyclohexylcarbamate;(3-sulfanylphenyl)methanol |
|---|---|
| PubChem CID | 170639542 |
| Molecular Formula | C18H29NO3S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | tert-butyl N-cyclohexylcarbamate;(3-sulfanylphenyl)methanol |
| SMILES | CC(C)(C)OC(=O)NC1CCCCC1.OCc1cccc(S)c1 |
| InChI | InChI=1S/C11H21NO2.C7H8OS/c1-11(2,3)14-10(13)12-9-7-5-4-6-8-9;8-5-6-2-1-3-7(9)4-6/h9H,4-8H2,1-3H3,(H,12,13);1-4,8-9H,5H2 |
| InChIKey | WVHDQNORMITKJY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|