C19H27ClN2O3 — CID 124674989
tert-butyl N-[(1R,3S)-3-[(3-chlorophenyl)methylcarbamoyl]cyclohexyl]carbamate (PubChem CID 124674989) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-[(3-chlorophenyl)methylcarbamoyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-[(3-chlorophenyl)methylcarbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 124674989 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-[(3-chlorophenyl)methylcarbamoyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C(=O)NCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H27ClN2O3/c1-19(2,3)25-18(24)22-16-9-5-7-14(11-16)17(23)21-12-13-6-4-8-15(20)10-13/h4,6,8,10,14,16H,5,7,9,11-12H2,1-3H3,(H,21,23)(H,22,24)/t14-,16+/m0/s1 |
| InChIKey | CBOWGFAXVOZPFT-GOEBONIOSA-N |
| XLogP | 4.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |