C18H27NO3S — CID 170639535
tert-butyl N-[4-[3-(hydroxymethyl)phenyl]sulfanylcyclohexyl]carbamate (PubChem CID 170639535) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is tert-butyl N-[4-[3-(hydroxymethyl)phenyl]sulfanylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-(hydroxymethyl)phenyl]sulfanylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 170639535 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl N-[4-[3-(hydroxymethyl)phenyl]sulfanylcyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Sc2cccc(CO)c2)CC1 |
| InChI | InChI=1S/C18H27NO3S/c1-18(2,3)22-17(21)19-14-7-9-15(10-8-14)23-16-6-4-5-13(11-16)12-20/h4-6,11,14-15,20H,7-10,12H2,1-3H3,(H,19,21) |
| InChIKey | OLKDAMQUOBSCDZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |