C21H22Cl2FN3O — CID 11396088
N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-3-fluorobenzamide (PubChem CID 11396088) has the molecular formula C21H22Cl2FN3O and a molecular weight of 422.33 g/mol. Its IUPAC name is N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-3-fluorobenzamide.
| Compound Name | N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 11396088 |
| Molecular Formula | C21H22Cl2FN3O |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-3-fluorobenzamide |
| SMILES | O=C(NC/C=C/CN1CCN(c2cccc(Cl)c2Cl)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H22Cl2FN3O/c22-18-7-4-8-19(20(18)23)27-13-11-26(12-14-27)10-2-1-9-25-21(28)16-5-3-6-17(24)15-16/h1-8,15H,9-14H2,(H,25,28)/b2-1+ |
| InChIKey | VCVHOTMCZLRSOP-OWOJBTEDSA-N |
| XLogP | 4.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|