C21H25Cl2N3O4 — CID 58899971
N-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]-3,4,5-trimethoxybenzamide (PubChem CID 58899971) has the molecular formula C21H25Cl2N3O4 and a molecular weight of 454.35 g/mol. Its IUPAC name is N-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 58899971 |
| Molecular Formula | C21H25Cl2N3O4 |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCN2CCN(c3cccc(Cl)c3Cl)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25Cl2N3O4/c1-28-17-11-14(12-18(29-2)20(17)30-3)21(27)24-13-25-7-9-26(10-8-25)16-6-4-5-15(22)19(16)23/h4-6,11-12H,7-10,13H2,1-3H3,(H,24,27) |
| InChIKey | CMBUAWKWQSYVET-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |