C29H38Cl2N4O — CID 70897852
1-butyl-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-5-phenyl-2,3-dihydropyrrole-3-carboxamide (PubChem CID 70897852) has the molecular formula C29H38Cl2N4O and a molecular weight of 529.56 g/mol. Its IUPAC name is 1-butyl-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-5-phenyl-2,3-dihydropyrrole-3-carboxamide.
| Compound Name | 1-butyl-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-5-phenyl-2,3-dihydropyrrole-3-carboxamide |
|---|---|
| PubChem CID | 70897852 |
| Molecular Formula | C29H38Cl2N4O |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 1-butyl-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-5-phenyl-2,3-dihydropyrrole-3-carboxamide |
| SMILES | CCCCN1C(c2ccccc2)=CC(C(=O)NCCCN2CCN(c3cccc(Cl)c3Cl)CC2)C1C |
| InChI | InChI=1S/C29H38Cl2N4O/c1-3-4-16-35-22(2)24(21-27(35)23-10-6-5-7-11-23)29(36)32-14-9-15-33-17-19-34(20-18-33)26-13-8-12-25(30)28(26)31/h5-8,10-13,21-22,24H,3-4,9,14-20H2,1-2H3,(H,32,36) |
| InChIKey | AUFMMDDKKREYLO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|