C25H29Cl3N4O — CID 89079192
2-chloro-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-methyl-5-phenyl-2,3-dihydropyrrole-3-carboxamide (PubChem CID 89079192) has the molecular formula C25H29Cl3N4O and a molecular weight of 507.89 g/mol. Its IUPAC name is 2-chloro-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-methyl-5-phenyl-2,3-dihydropyrrole-3-carboxamide.
| Compound Name | 2-chloro-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-methyl-5-phenyl-2,3-dihydropyrrole-3-carboxamide |
|---|---|
| PubChem CID | 89079192 |
| Molecular Formula | C25H29Cl3N4O |
| Molecular Weight | 507.89 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 2-chloro-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-methyl-5-phenyl-2,3-dihydropyrrole-3-carboxamide |
| SMILES | CN1C(c2ccccc2)=CC(C(=O)NCCCN2CCN(c3cccc(Cl)c3Cl)CC2)C1Cl |
| InChI | InChI=1S/C25H29Cl3N4O/c1-30-22(18-7-3-2-4-8-18)17-19(24(30)28)25(33)29-11-6-12-31-13-15-32(16-14-31)21-10-5-9-20(26)23(21)27/h2-5,7-10,17,19,24H,6,11-16H2,1H3,(H,29,33) |
| InChIKey | YZIABJRFMCARND-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|