C14H20ClFN2O — CID 92770253
2-[(2S)-4-[(2-chloro-6-fluorophenyl)methyl]-1-methylpiperazin-2-yl]ethanol (PubChem CID 92770253) has the molecular formula C14H20ClFN2O and a molecular weight of 286.78 g/mol. Its IUPAC name is 2-[(2S)-4-[(2-chloro-6-fluorophenyl)methyl]-1-methylpiperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-[(2-chloro-6-fluorophenyl)methyl]-1-methylpiperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 92770253 |
| Molecular Formula | C14H20ClFN2O |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-[(2S)-4-[(2-chloro-6-fluorophenyl)methyl]-1-methylpiperazin-2-yl]ethanol |
| SMILES | CN1CCN(Cc2c(F)cccc2Cl)C[C@@H]1CCO |
| InChI | InChI=1S/C14H20ClFN2O/c1-17-6-7-18(9-11(17)5-8-19)10-12-13(15)3-2-4-14(12)16/h2-4,11,19H,5-10H2,1H3/t11-/m0/s1 |
| InChIKey | GBHHQVIOMSAFEW-NSHDSACASA-N |
| XLogP | 1.98 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |