C18H23ClN2O2 — CID 98575794
2-[(2R)-4-[[5-(2-chlorophenyl)furan-2-yl]methyl]-1-methylpiperazin-2-yl]ethanol (PubChem CID 98575794) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 2-[(2R)-4-[[5-(2-chlorophenyl)furan-2-yl]methyl]-1-methylpiperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-4-[[5-(2-chlorophenyl)furan-2-yl]methyl]-1-methylpiperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 98575794 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-[(2R)-4-[[5-(2-chlorophenyl)furan-2-yl]methyl]-1-methylpiperazin-2-yl]ethanol |
| SMILES | CN1CCN(Cc2ccc(-c3ccccc3Cl)o2)C[C@H]1CCO |
| InChI | InChI=1S/C18H23ClN2O2/c1-20-9-10-21(12-14(20)8-11-22)13-15-6-7-18(23-15)16-4-2-3-5-17(16)19/h2-7,14,22H,8-13H2,1H3/t14-/m1/s1 |
| InChIKey | INQYXBDWBAKYFL-CQSZACIVSA-N |
| XLogP | 3.10 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |