C18H28ClFN2 — CID 60505494
N-[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]methyl]-N-methylbutan-1-amine (PubChem CID 60505494) has the molecular formula C18H28ClFN2 and a molecular weight of 326.89 g/mol. Its IUPAC name is N-[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]methyl]-N-methylbutan-1-amine.
| Compound Name | N-[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]methyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 60505494 |
| Molecular Formula | C18H28ClFN2 |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | N-[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]methyl]-N-methylbutan-1-amine |
| SMILES | CCCCN(C)CC1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C18H28ClFN2/c1-3-4-10-21(2)13-15-8-11-22(12-9-15)14-16-17(19)6-5-7-18(16)20/h5-7,15H,3-4,8-14H2,1-2H3 |
| InChIKey | WSVARVMJMZALRZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |