C16H20ClFN2O2 — CID 95990935
(3S)-1-[(2-chloro-6-fluorophenyl)methyl]-3-morpholin-4-ylpiperidin-2-one (PubChem CID 95990935) has the molecular formula C16H20ClFN2O2 and a molecular weight of 326.80 g/mol. Its IUPAC name is (3S)-1-[(2-chloro-6-fluorophenyl)methyl]-3-morpholin-4-ylpiperidin-2-one.
| Compound Name | (3S)-1-[(2-chloro-6-fluorophenyl)methyl]-3-morpholin-4-ylpiperidin-2-one |
|---|---|
| PubChem CID | 95990935 |
| Molecular Formula | C16H20ClFN2O2 |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (3S)-1-[(2-chloro-6-fluorophenyl)methyl]-3-morpholin-4-ylpiperidin-2-one |
| SMILES | O=C1[C@@H](N2CCOCC2)CCCN1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H20ClFN2O2/c17-13-3-1-4-14(18)12(13)11-20-6-2-5-15(16(20)21)19-7-9-22-10-8-19/h1,3-4,15H,2,5-11H2/t15-/m0/s1 |
| InChIKey | MOTVUQQJYAZTLA-HNNXBMFYSA-N |
| XLogP | 2.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |