About 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole
2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole (PubChem CID 171334425) has the molecular formula C16H15F3N6S
and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole |
| PubChem CID | 171334425 |
| Molecular Formula | C16H15F3N6S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1csc(CN2CCN(c3ncnc4cnccc34)CC2)n1 |
| InChI | InChI=1S/C16H15F3N6S/c17-16(18,19)13-9-26-14(23-13)8-24-3-5-25(6-4-24)15-11-1-2-20-7-12(11)21-10-22-15/h1-2,7,9-10H,3-6,8H2 |
| InChIKey | SNKSYQBXVSTWJI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole?
The IUPAC name of 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole (CID 171334425) is 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole.
What is the SMILES notation for 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole?
The canonical SMILES for 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole is FC(F)(F)c1csc(CN2CCN(c3ncnc4cnccc34)CC2)n1.
What is the InChIKey of 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole?
The InChIKey is SNKSYQBXVSTWJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F3N6S/c17-16(18,19)13-9-26-14(23-13)8-24-3-5-25(6-4-24)15-11-1-2-20-7-12(11)21-10-22-15/h1-2,7,9-10H,3-6,8H2.
What are the key properties of 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole?
2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole has a molecular weight of 380.40 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-pyrido[3,4-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-4-(trifluoromethyl)-1,3-thiazole is sourced from PubChem (CID 171334425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).