C15H19FN4 — CID 83173958
7-fluoro-8-(4-methyl-1,4-diazepan-1-yl)quinolin-5-amine (PubChem CID 83173958) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is 7-fluoro-8-(4-methyl-1,4-diazepan-1-yl)quinolin-5-amine.
| Compound Name | 7-fluoro-8-(4-methyl-1,4-diazepan-1-yl)quinolin-5-amine |
|---|---|
| PubChem CID | 83173958 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 7-fluoro-8-(4-methyl-1,4-diazepan-1-yl)quinolin-5-amine |
| SMILES | CN1CCCN(c2c(F)cc(N)c3cccnc23)CC1 |
| InChI | InChI=1S/C15H19FN4/c1-19-6-3-7-20(9-8-19)15-12(16)10-13(17)11-4-2-5-18-14(11)15/h2,4-5,10H,3,6-9,17H2,1H3 |
| InChIKey | HLNVCMHRNJIMCW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|