C16H20FN3O — CID 107403613
1-(5-amino-7-fluoroquinolin-8-yl)-4-methylazepan-4-ol (PubChem CID 107403613) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-(5-amino-7-fluoroquinolin-8-yl)-4-methylazepan-4-ol.
| Compound Name | 1-(5-amino-7-fluoroquinolin-8-yl)-4-methylazepan-4-ol |
|---|---|
| PubChem CID | 107403613 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-(5-amino-7-fluoroquinolin-8-yl)-4-methylazepan-4-ol |
| SMILES | CC1(O)CCCN(c2c(F)cc(N)c3cccnc23)CC1 |
| InChI | InChI=1S/C16H20FN3O/c1-16(21)5-3-8-20(9-6-16)15-12(17)10-13(18)11-4-2-7-19-14(11)15/h2,4,7,10,21H,3,5-6,8-9,18H2,1H3 |
| InChIKey | REFOJDGEYCCSLC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|