C16H18FN3O — CID 83166153
8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-7-fluoroquinolin-5-amine (PubChem CID 83166153) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is 8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-7-fluoroquinolin-5-amine.
| Compound Name | 8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-7-fluoroquinolin-5-amine |
|---|---|
| PubChem CID | 83166153 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-7-fluoroquinolin-5-amine |
| SMILES | Nc1cc(F)c(N2CCOC3CCCC32)c2ncccc12 |
| InChI | InChI=1S/C16H18FN3O/c17-11-9-12(18)10-3-2-6-19-15(10)16(11)20-7-8-21-14-5-1-4-13(14)20/h2-3,6,9,13-14H,1,4-5,7-8,18H2 |
| InChIKey | QNPPJSHNLVBCIB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|